C20H32N4O4S — CID 47047056
1-butylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-4-carboxamide (PubChem CID 47047056) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-butylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47047056 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 1-butylsulfonyl-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NCc2ccnc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C20H32N4O4S/c1-2-3-14-29(26,27)24-8-5-18(6-9-24)20(25)22-16-17-4-7-21-19(15-17)23-10-12-28-13-11-23/h4,7,15,18H,2-3,5-6,8-14,16H2,1H3,(H,22,25) |
| InChIKey | LIDAUGDDPUSXDR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |