C20H31N3O4S — CID 55764759
1-butylsulfonyl-N-(2-morpholin-4-ylphenyl)piperidine-4-carboxamide (PubChem CID 55764759) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is 1-butylsulfonyl-N-(2-morpholin-4-ylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-(2-morpholin-4-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55764759 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-butylsulfonyl-N-(2-morpholin-4-ylphenyl)piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)Nc2ccccc2N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H31N3O4S/c1-2-3-16-28(25,26)23-10-8-17(9-11-23)20(24)21-18-6-4-5-7-19(18)22-12-14-27-15-13-22/h4-7,17H,2-3,8-16H2,1H3,(H,21,24) |
| InChIKey | MEQBRGHJLQHRGT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |