C18H26N2O4S — CID 113007849
N-(3-acetylphenyl)-1-butylsulfonylpiperidine-4-carboxamide (PubChem CID 113007849) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1-butylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-1-butylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 113007849 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-(3-acetylphenyl)-1-butylsulfonylpiperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)Nc2cccc(C(C)=O)c2)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-3-4-12-25(23,24)20-10-8-15(9-11-20)18(22)19-17-7-5-6-16(13-17)14(2)21/h5-7,13,15H,3-4,8-12H2,1-2H3,(H,19,22) |
| InChIKey | CFCGQWBAFVMHGW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |