C21H24N2O5S — CID 9299938
1-(3-acetylphenyl)sulfonyl-N-[3-(hydroxymethyl)phenyl]piperidine-4-carboxamide (PubChem CID 9299938) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-(3-acetylphenyl)sulfonyl-N-[3-(hydroxymethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(3-acetylphenyl)sulfonyl-N-[3-(hydroxymethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9299938 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-(3-acetylphenyl)sulfonyl-N-[3-(hydroxymethyl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)Nc3cccc(CO)c3)CC2)c1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15(25)18-5-3-7-20(13-18)29(27,28)23-10-8-17(9-11-23)21(26)22-19-6-2-4-16(12-19)14-24/h2-7,12-13,17,24H,8-11,14H2,1H3,(H,22,26) |
| InChIKey | SSUXXQLGKHDHDD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |