C22H26N2O4S — CID 34830036
N-(3-acetylphenyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 34830036) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 34830036 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-(3-acetylphenyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)c(C)c3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O4S/c1-15-7-8-21(13-16(15)2)29(27,28)24-11-9-18(10-12-24)22(26)23-20-6-4-5-19(14-20)17(3)25/h4-8,13-14,18H,9-12H2,1-3H3,(H,23,26) |
| InChIKey | RJJWGGRQSIYYQQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |