C17H26ClN3O5S — CID 119618314
N-(6-amino-1,3-benzodioxol-5-yl)-1-butylsulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119618314) has the molecular formula C17H26ClN3O5S and a molecular weight of 419.93 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-1-butylsulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-butylsulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119618314 |
| Molecular Formula | C17H26ClN3O5S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-butylsulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)Nc2cc3c(cc2N)OCO3)CC1.Cl |
| InChI | InChI=1S/C17H25N3O5S.ClH/c1-2-3-8-26(22,23)20-6-4-12(5-7-20)17(21)19-14-10-16-15(9-13(14)18)24-11-25-16;/h9-10,12H,2-8,11,18H2,1H3,(H,19,21);1H |
| InChIKey | FRFXXJMHASLKRY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|