C18H26ClN3O4 — CID 119618169
N-(6-amino-1,3-benzodioxol-5-yl)-1-(2-methylbutanoyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119618169) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-1-(2-methylbutanoyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(2-methylbutanoyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119618169 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(2-methylbutanoyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | CCC(C)C(=O)N1CCCC(C(=O)Nc2cc3c(cc2N)OCO3)C1.Cl |
| InChI | InChI=1S/C18H25N3O4.ClH/c1-3-11(2)18(23)21-6-4-5-12(9-21)17(22)20-14-8-16-15(7-13(14)19)24-10-25-16;/h7-8,11-12H,3-6,9-10,19H2,1-2H3,(H,20,22);1H |
| InChIKey | SGDSYLYNYKYCKC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|