C21H24ClN3O4 — CID 119618843
N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-methylbenzoyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119618843) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-methylbenzoyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-methylbenzoyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119618843 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-methylbenzoyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)Nc3cc4c(cc3N)OCO4)C2)cc1.Cl |
| InChI | InChI=1S/C21H23N3O4.ClH/c1-13-4-6-14(7-5-13)21(26)24-8-2-3-15(11-24)20(25)23-17-10-19-18(9-16(17)22)27-12-28-19;/h4-7,9-10,15H,2-3,8,11-12,22H2,1H3,(H,23,25);1H |
| InChIKey | SSKGPNYTACBQJW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|