C20H21ClFN3O4 — CID 119617969
N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-fluorobenzoyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119617969) has the molecular formula C20H21ClFN3O4 and a molecular weight of 421.86 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-fluorobenzoyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-fluorobenzoyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119617969 |
| Molecular Formula | C20H21ClFN3O4 |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-1-(4-fluorobenzoyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.Nc1cc2c(cc1NC(=O)C1CCCN(C(=O)c3ccc(F)cc3)C1)OCO2 |
| InChI | InChI=1S/C20H20FN3O4.ClH/c21-14-5-3-12(4-6-14)20(26)24-7-1-2-13(10-24)19(25)23-16-9-18-17(8-15(16)22)27-11-28-18;/h3-6,8-9,13H,1-2,7,10-11,22H2,(H,23,25);1H |
| InChIKey | LLZPBMPJYSUISL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|