C22H23FN2O4 — CID 18143619
N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide (PubChem CID 18143619) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 18143619 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCCN(C(=O)c2ccc(F)cc2)C1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H23FN2O4/c1-14(16-6-9-19-20(11-16)29-13-28-19)24-21(26)17-3-2-10-25(12-17)22(27)15-4-7-18(23)8-5-15/h4-9,11,14,17H,2-3,10,12-13H2,1H3,(H,24,26) |
| InChIKey | RQQHOFVFMSLHKV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |