C20H31ClN2O3S — CID 55770352
1-butylsulfonyl-N-(3-chloro-2,6-diethylphenyl)piperidine-4-carboxamide (PubChem CID 55770352) has the molecular formula C20H31ClN2O3S and a molecular weight of 415.00 g/mol. Its IUPAC name is 1-butylsulfonyl-N-(3-chloro-2,6-diethylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-(3-chloro-2,6-diethylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55770352 |
| Molecular Formula | C20H31ClN2O3S |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-butylsulfonyl-N-(3-chloro-2,6-diethylphenyl)piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)Nc2c(CC)ccc(Cl)c2CC)CC1 |
| InChI | InChI=1S/C20H31ClN2O3S/c1-4-7-14-27(25,26)23-12-10-16(11-13-23)20(24)22-19-15(5-2)8-9-18(21)17(19)6-3/h8-9,16H,4-7,10-14H2,1-3H3,(H,22,24) |
| InChIKey | VWMVTFVFHVDTNN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |