C25H29ClN2O2 — CID 42999507
N-(3-chloro-2,6-diethylphenyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 42999507) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42999507 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29ClN2O2/c1-3-19-11-12-22(26)21(4-2)24(19)27-25(30)20-14-16-28(17-15-20)23(29)13-10-18-8-6-5-7-9-18/h5-13,20H,3-4,14-17H2,1-2H3,(H,27,30)/b13-10+ |
| InChIKey | VBOBACVTSZFBJT-JLHYYAGUSA-N |
| XLogP | 5.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|