C26H30N2O4 — CID 31653002
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 31653002) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31653002 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N2O4/c1-3-21-11-7-8-19(2)25(21)27-23(29)18-32-26(31)22-14-16-28(17-15-22)24(30)13-12-20-9-5-4-6-10-20/h4-13,22H,3,14-18H2,1-2H3,(H,27,29)/b13-12+ |
| InChIKey | LCMNOKDYLWZBDC-OUKQBFOZSA-N |
| XLogP | 3.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|