C24H27FN2O4 — CID 46660883
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate (PubChem CID 46660883) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46660883 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)C1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H27FN2O4/c1-3-17-7-4-6-16(2)22(17)26-21(28)15-31-24(30)19-8-5-13-27(14-19)23(29)18-9-11-20(25)12-10-18/h4,6-7,9-12,19H,3,5,8,13-15H2,1-2H3,(H,26,28) |
| InChIKey | LJRBFEQWXLDUCD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |