C21H27FN2O4 — CID 55345207
ethyl 1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidine-3-carboxylate (PubChem CID 55345207) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55345207 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | ethyl 1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C21H27FN2O4/c1-2-28-21(27)17-4-3-11-24(14-17)20(26)16-9-12-23(13-10-16)19(25)15-5-7-18(22)8-6-15/h5-8,16-17H,2-4,9-14H2,1H3 |
| InChIKey | YLZKEMBFQPMLRT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |