C19H26N2O5 — CID 17081710
ethyl 1-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperidine-3-carboxylate (PubChem CID 17081710) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 1-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 17081710 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | ethyl 1-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C2CCN(C(=O)c3ccco3)CC2)C1 |
| InChI | InChI=1S/C19H26N2O5/c1-2-25-19(24)15-5-3-9-21(13-15)17(22)14-7-10-20(11-8-14)18(23)16-6-4-12-26-16/h4,6,12,14-15H,2-3,5,7-11,13H2,1H3 |
| InChIKey | AJESVIOYQKKGID-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |