C22H32N4O4 — CID 55440443
2-[4-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 55440443) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[4-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 55440443 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[4-[1-(furan-2-carbonyl)piperidine-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCN(C(=O)C2CCN(C(=O)c3ccco3)CC2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C22H32N4O4/c27-20(24-8-2-1-3-9-24)17-23-12-14-26(15-13-23)21(28)18-6-10-25(11-7-18)22(29)19-5-4-16-30-19/h4-5,16,18H,1-3,6-15,17H2 |
| InChIKey | QVNGJCWRTYWPIN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |