C12H16N2O4 — CID 55119191
2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 55119191) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 55119191 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C12H16N2O4/c15-11(16)9-13-4-2-5-14(7-6-13)12(17)10-3-1-8-18-10/h1,3,8H,2,4-7,9H2,(H,15,16) |
| InChIKey | QVIFUGQOYPAVMI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |