C15H20N2O3 — CID 62825320
2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62825320) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62825320 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H20N2O3/c18-14(11-13-5-2-1-3-6-13)17-8-4-7-16(9-10-17)12-15(19)20/h1-3,5-6H,4,7-12H2,(H,19,20) |
| InChIKey | GNECXLCHRCAHET-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |