2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid

C15H20N2O3 — CID 62825320

IUPAC2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(C(=O)Cc2ccccc2)CC1
InChIInChI=1S/C15H20N2O3/c18-14(11-13-5-2-1-3-6-13)17-8-4-7-16(9-10-17)12-15(19)20/h1-3,5-6H,4,7-12H2,(H,19,20)
InChIKeyGNECXLCHRCAHET-UHFFFAOYSA-N
MW276.34 g/mol
LogP0.85
Rot. Bonds4

About 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid

2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62825320) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid
PubChem CID62825320
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Name2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(C(=O)Cc2ccccc2)CC1
InChIInChI=1S/C15H20N2O3/c18-14(11-13-5-2-1-3-6-13)17-8-4-7-16(9-10-17)12-15(19)20/h1-3,5-6H,4,7-12H2,(H,19,20)
InChIKeyGNECXLCHRCAHET-UHFFFAOYSA-N
XLogP0.85
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid (CID 62825320) is 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(C(=O)Cc2ccccc2)CC1.
What is the InChIKey of 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is GNECXLCHRCAHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c18-14(11-13-5-2-1-3-6-13)17-8-4-7-16(9-10-17)12-15(19)20/h1-3,5-6H,4,7-12H2,(H,19,20).
What are the key properties of 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 276.34 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-phenylacetyl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62825320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).