C16H22N2O — CID 95750020
2-phenyl-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone (PubChem CID 95750020) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-phenyl-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-phenyl-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 95750020 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-phenyl-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone |
| SMILES | C=CCN1CCCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H22N2O/c1-2-9-17-10-6-11-18(13-12-17)16(19)14-15-7-4-3-5-8-15/h2-5,7-8H,1,6,9-14H2 |
| InChIKey | KGLOKTVJHLCPST-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|