C20H23N3O2 — CID 110811558
N-phenyl-4-(2-phenylacetyl)-1,4-diazepane-1-carboxamide (PubChem CID 110811558) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-phenyl-4-(2-phenylacetyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-phenyl-4-(2-phenylacetyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110811558 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-phenyl-4-(2-phenylacetyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Cc1ccccc1)N1CCCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3O2/c24-19(16-17-8-3-1-4-9-17)22-12-7-13-23(15-14-22)20(25)21-18-10-5-2-6-11-18/h1-6,8-11H,7,12-16H2,(H,21,25) |
| InChIKey | VYPWUCQPMJZVHD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |