C20H24N4O4S — CID 8544458
2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 8544458) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 8544458 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H24N4O4S/c25-18(22-9-11-24(12-10-22)20(27)17-4-2-14-29-17)15-21-5-7-23(8-6-21)19(26)16-3-1-13-28-16/h1-4,13-14H,5-12,15H2 |
| InChIKey | WISSJGZQLGANFF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |