C21H25ClN4O2S — CID 17414280
2-[4-(3-chlorophenyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 17414280) has the molecular formula C21H25ClN4O2S and a molecular weight of 432.98 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17414280 |
| Molecular Formula | C21H25ClN4O2S |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2cccc(Cl)c2)CC1)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C21H25ClN4O2S/c22-17-3-1-4-18(15-17)24-8-6-23(7-9-24)16-20(27)25-10-12-26(13-11-25)21(28)19-5-2-14-29-19/h1-5,14-15H,6-13,16H2 |
| InChIKey | QJLWLNUSCMXPHN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |