C22H27ClN4O3S — CID 2595436
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]ethanone (PubChem CID 2595436) has the molecular formula C22H27ClN4O3S and a molecular weight of 463.00 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 2595436 |
| Molecular Formula | C22H27ClN4O3S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-[4-(3-chlorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2cccc(Cl)c2)CC1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27ClN4O3S/c23-19-5-4-6-20(17-19)25-11-9-24(10-12-25)18-22(28)26-13-15-27(16-14-26)31(29,30)21-7-2-1-3-8-21/h1-8,17H,9-16,18H2 |
| InChIKey | QZDFTMJIPRIPAV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |