C17H27ClN4O3S — CID 119908256
2-(4-aminopiperidin-1-yl)-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 119908256) has the molecular formula C17H27ClN4O3S and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-aminopiperidin-1-yl)-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119908256 |
| Molecular Formula | C17H27ClN4O3S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-1-[4-(benzenesulfonyl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.NC1CCN(CC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C17H26N4O3S.ClH/c18-15-6-8-19(9-7-15)14-17(22)20-10-12-21(13-11-20)25(23,24)16-4-2-1-3-5-16;/h1-5,15H,6-14,18H2;1H |
| InChIKey | DYFXPAPEMCYZFW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |