C17H27N3O3S — CID 119678275
7-amino-1-[4-(benzenesulfonyl)piperazin-1-yl]heptan-1-one (PubChem CID 119678275) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 7-amino-1-[4-(benzenesulfonyl)piperazin-1-yl]heptan-1-one.
| Compound Name | 7-amino-1-[4-(benzenesulfonyl)piperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 119678275 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 7-amino-1-[4-(benzenesulfonyl)piperazin-1-yl]heptan-1-one |
| SMILES | NCCCCCCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H27N3O3S/c18-11-7-2-1-6-10-17(21)19-12-14-20(15-13-19)24(22,23)16-8-4-3-5-9-16/h3-5,8-9H,1-2,6-7,10-15,18H2 |
| InChIKey | AFJUNTNTYQGXBN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|