C24H32N2O4S — CID 16550663
1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(4-tert-butylphenoxy)butan-1-one (PubChem CID 16550663) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(4-tert-butylphenoxy)butan-1-one.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(4-tert-butylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 16550663 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-4-(4-tert-butylphenoxy)butan-1-one |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-24(2,3)20-11-13-21(14-12-20)30-19-7-10-23(27)25-15-17-26(18-16-25)31(28,29)22-8-5-4-6-9-22/h4-6,8-9,11-14H,7,10,15-19H2,1-3H3 |
| InChIKey | OGAHLPOPEGNBQE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|