C26H34N2O5S — CID 55399530
4-[4-[2-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]butan-2-one (PubChem CID 55399530) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]butan-2-one.
| Compound Name | 4-[4-[2-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]butan-2-one |
|---|---|
| PubChem CID | 55399530 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 4-[4-[2-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]butan-2-one |
| SMILES | CC(=O)CCc1ccc(OCC(=O)N2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O5S/c1-20(29)5-6-21-7-11-23(12-8-21)33-19-25(30)27-15-17-28(18-16-27)34(31,32)24-13-9-22(10-14-24)26(2,3)4/h7-14H,5-6,15-19H2,1-4H3 |
| InChIKey | MAUXSNRMRLBPRS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |