C23H35N3O5S — CID 55840674
N-cyclohexyl-N-methyl-4-[2-[4-(3-oxobutyl)phenoxy]acetyl]piperazine-1-sulfonamide (PubChem CID 55840674) has the molecular formula C23H35N3O5S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[2-[4-(3-oxobutyl)phenoxy]acetyl]piperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[2-[4-(3-oxobutyl)phenoxy]acetyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55840674 |
| Molecular Formula | C23H35N3O5S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[2-[4-(3-oxobutyl)phenoxy]acetyl]piperazine-1-sulfonamide |
| SMILES | CC(=O)CCc1ccc(OCC(=O)N2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O5S/c1-19(27)8-9-20-10-12-22(13-11-20)31-18-23(28)25-14-16-26(17-15-25)32(29,30)24(2)21-6-4-3-5-7-21/h10-13,21H,3-9,14-18H2,1-2H3 |
| InChIKey | VWUALCVUCLDEKR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |