C16H33ClN4O3S — CID 120560520
4-(4-aminopentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide;hydrochloride (PubChem CID 120560520) has the molecular formula C16H33ClN4O3S and a molecular weight of 396.99 g/mol. Its IUPAC name is 4-(4-aminopentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide;hydrochloride.
| Compound Name | 4-(4-aminopentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120560520 |
| Molecular Formula | C16H33ClN4O3S |
| Molecular Weight | 396.99 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-(4-aminopentanoyl)-N-cyclohexyl-N-methylpiperazine-1-sulfonamide;hydrochloride |
| SMILES | CC(N)CCC(=O)N1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C16H32N4O3S.ClH/c1-14(17)8-9-16(21)19-10-12-20(13-11-19)24(22,23)18(2)15-6-4-3-5-7-15;/h14-15H,3-13,17H2,1-2H3;1H |
| InChIKey | YXOGBLCVUNJDKG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.99 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |