C15H28N4O5S — CID 122019342
3-[[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]amino]propanoic acid (PubChem CID 122019342) has the molecular formula C15H28N4O5S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-[[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122019342 |
| Molecular Formula | C15H28N4O5S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]amino]propanoic acid |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(C(=O)NCCC(=O)O)CC1 |
| InChI | InChI=1S/C15H28N4O5S/c1-17(13-5-3-2-4-6-13)25(23,24)19-11-9-18(10-12-19)15(22)16-8-7-14(20)21/h13H,2-12H2,1H3,(H,16,22)(H,20,21) |
| InChIKey | FLXLMHQNOAHQSF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |