C20H29N3O5S — CID 55599328
methyl 4-[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]benzoate (PubChem CID 55599328) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is methyl 4-[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 55599328 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | methyl 4-[4-[cyclohexyl(methyl)sulfamoyl]piperazine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O5S/c1-21(18-6-4-3-5-7-18)29(26,27)23-14-12-22(13-15-23)19(24)16-8-10-17(11-9-16)20(25)28-2/h8-11,18H,3-7,12-15H2,1-2H3 |
| InChIKey | IBLZNYCLGXNEGF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |