C21H30N4O5S2 — CID 55599290
N-cyclohexyl-N-methyl-4-[3-(prop-2-ynylsulfamoyl)benzoyl]piperazine-1-sulfonamide (PubChem CID 55599290) has the molecular formula C21H30N4O5S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[3-(prop-2-ynylsulfamoyl)benzoyl]piperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[3-(prop-2-ynylsulfamoyl)benzoyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55599290 |
| Molecular Formula | C21H30N4O5S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[3-(prop-2-ynylsulfamoyl)benzoyl]piperazine-1-sulfonamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)N2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C21H30N4O5S2/c1-3-12-22-31(27,28)20-11-7-8-18(17-20)21(26)24-13-15-25(16-14-24)32(29,30)23(2)19-9-5-4-6-10-19/h1,7-8,11,17,19,22H,4-6,9-10,12-16H2,2H3 |
| InChIKey | BODOKZXPANFXFT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|