C22H35N3O5S — CID 55599312
N-cyclohexyl-4-(3,4-diethoxybenzoyl)-N-methylpiperazine-1-sulfonamide (PubChem CID 55599312) has the molecular formula C22H35N3O5S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-cyclohexyl-4-(3,4-diethoxybenzoyl)-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-4-(3,4-diethoxybenzoyl)-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55599312 |
| Molecular Formula | C22H35N3O5S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-cyclohexyl-4-(3,4-diethoxybenzoyl)-N-methylpiperazine-1-sulfonamide |
| SMILES | CCOc1ccc(C(=O)N2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)cc1OCC |
| InChI | InChI=1S/C22H35N3O5S/c1-4-29-20-12-11-18(17-21(20)30-5-2)22(26)24-13-15-25(16-14-24)31(27,28)23(3)19-9-7-6-8-10-19/h11-12,17,19H,4-10,13-16H2,1-3H3 |
| InChIKey | PRKOZYNEGMQFMI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |