C21H34N4O4S — CID 55626263
2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-ethoxyphenyl)acetamide (PubChem CID 55626263) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55626263 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H34N4O4S/c1-3-29-20-12-8-7-11-19(20)22-21(26)17-24-13-15-25(16-14-24)30(27,28)23(2)18-9-5-4-6-10-18/h7-8,11-12,18H,3-6,9-10,13-17H2,1-2H3,(H,22,26) |
| InChIKey | QYFSVNRMDJSXJT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |