C21H31N5O3S — CID 55626339
N-(2-cyanophenyl)-3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]propanamide (PubChem CID 55626339) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is N-(2-cyanophenyl)-3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]propanamide.
| Compound Name | N-(2-cyanophenyl)-3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55626339 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-(2-cyanophenyl)-3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]propanamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(CCC(=O)Nc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C21H31N5O3S/c1-24(19-8-3-2-4-9-19)30(28,29)26-15-13-25(14-16-26)12-11-21(27)23-20-10-6-5-7-18(20)17-22/h5-7,10,19H,2-4,8-9,11-16H2,1H3,(H,23,27) |
| InChIKey | OJXMBZDVTFJCNG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |