C19H36N4O3S — CID 55988325
3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-cyclopentylpropanamide (PubChem CID 55988325) has the molecular formula C19H36N4O3S and a molecular weight of 400.59 g/mol. Its IUPAC name is 3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-cyclopentylpropanamide.
| Compound Name | 3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 55988325 |
| Molecular Formula | C19H36N4O3S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 3-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-cyclopentylpropanamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(CCC(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C19H36N4O3S/c1-21(18-9-3-2-4-10-18)27(25,26)23-15-13-22(14-16-23)12-11-19(24)20-17-7-5-6-8-17/h17-18H,2-16H2,1H3,(H,20,24) |
| InChIKey | LOSYDGQQILYNEX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |