C20H37N5O4S — CID 55626303
N-(1-acetylpiperidin-4-yl)-2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]acetamide (PubChem CID 55626303) has the molecular formula C20H37N5O4S and a molecular weight of 443.61 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55626303 |
| Molecular Formula | C20H37N5O4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]acetamide |
| SMILES | CC(=O)N1CCC(NC(=O)CN2CCN(S(=O)(=O)N(C)C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C20H37N5O4S/c1-17(26)24-10-8-18(9-11-24)21-20(27)16-23-12-14-25(15-13-23)30(28,29)22(2)19-6-4-3-5-7-19/h18-19H,3-16H2,1-2H3,(H,21,27) |
| InChIKey | TYQLNZJHSCUTLX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |