C21H36N6O5S — CID 55626242
2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55626242) has the molecular formula C21H36N6O5S and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55626242 |
| Molecular Formula | C21H36N6O5S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(CC(=O)NN2C(=O)NC3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C21H36N6O5S/c1-24(17-8-4-2-5-9-17)33(31,32)26-14-12-25(13-15-26)16-18(28)23-27-19(29)21(22-20(27)30)10-6-3-7-11-21/h17H,2-16H2,1H3,(H,22,30)(H,23,28) |
| InChIKey | XOQHWTWGFQBGIN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|