C23H38N4O3S — CID 55625884
2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide (PubChem CID 55625884) has the molecular formula C23H38N4O3S and a molecular weight of 450.65 g/mol. Its IUPAC name is 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide.
| Compound Name | 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 55625884 |
| Molecular Formula | C23H38N4O3S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 2-[4-[cyclohexyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide |
| SMILES | CC(C)C(NC(=O)CN1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H38N4O3S/c1-19(2)23(20-10-6-4-7-11-20)24-22(28)18-26-14-16-27(17-15-26)31(29,30)25(3)21-12-8-5-9-13-21/h4,6-7,10-11,19,21,23H,5,8-9,12-18H2,1-3H3,(H,24,28) |
| InChIKey | UWMYCZWWFTXXIA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |