C18H30N4O3S — CID 17428462
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide (PubChem CID 17428462) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 17428462 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H30N4O3S/c1-4-21(5-2)26(24,25)22-13-11-20(12-14-22)15-18(23)19-16(3)17-9-7-6-8-10-17/h6-10,16H,4-5,11-15H2,1-3H3,(H,19,23) |
| InChIKey | WGZSYRHNFUMJFU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |