C23H32N4O3 — CID 47547029
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-(4-phenylcyclohexyl)amino]acetamide (PubChem CID 47547029) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-(4-phenylcyclohexyl)amino]acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-(4-phenylcyclohexyl)amino]acetamide |
|---|---|
| PubChem CID | 47547029 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[methyl-(4-phenylcyclohexyl)amino]acetamide |
| SMILES | CN(CC(=O)NN1C(=O)NC2(CCCCC2)C1=O)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-26(19-12-10-18(11-13-19)17-8-4-2-5-9-17)16-20(28)25-27-21(29)23(24-22(27)30)14-6-3-7-15-23/h2,4-5,8-9,18-19H,3,6-7,10-16H2,1H3,(H,24,30)(H,25,28) |
| InChIKey | FBRNGWIUUCVASD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|