C24H25N3O6 — CID 16500399
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 16500399) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 16500399 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(O)(c1ccccc1)c1ccccc1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C24H25N3O6/c28-19(26-27-20(29)23(25-22(27)31)14-8-3-9-15-23)16-33-21(30)24(32,17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13,32H,3,8-9,14-16H2,(H,25,31)(H,26,28) |
| InChIKey | UIOLRPQPSWWPEJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|