C18H20ClN3O5 — CID 8579141
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate (PubChem CID 8579141) has the molecular formula C18H20ClN3O5 and a molecular weight of 393.83 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8579141 |
| Molecular Formula | C18H20ClN3O5 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(Cl)cc1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C18H20ClN3O5/c19-13-6-4-12(5-7-13)10-15(24)27-11-14(23)21-22-16(25)18(20-17(22)26)8-2-1-3-9-18/h4-7H,1-3,8-11H2,(H,20,26)(H,21,23) |
| InChIKey | YRHXJZJOTNHBQF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|