C17H18FN3O5 — CID 7873242
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-fluorobenzoate (PubChem CID 7873242) has the molecular formula C17H18FN3O5 and a molecular weight of 363.35 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 7873242 |
| Molecular Formula | C17H18FN3O5 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1F)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C17H18FN3O5/c18-12-7-3-2-6-11(12)14(23)26-10-13(22)20-21-15(24)17(19-16(21)25)8-4-1-5-9-17/h2-3,6-7H,1,4-5,8-10H2,(H,19,25)(H,20,22) |
| InChIKey | QVPWSVBPWWPURX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|