C18H18N4O5 — CID 7717000
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 7717000) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 7717000 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCC(=O)NN2C(=O)NC3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H18N4O5/c19-10-12-4-6-13(7-5-12)15(24)27-11-14(23)21-22-16(25)18(20-17(22)26)8-2-1-3-9-18/h4-7H,1-3,8-9,11H2,(H,20,26)(H,21,23) |
| InChIKey | XWJIKLHHGQTPHV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|