C17H19N3O5 — CID 7874358
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] benzoate (PubChem CID 7874358) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] benzoate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 7874358 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] benzoate |
| SMILES | O=C(COC(=O)c1ccccc1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C17H19N3O5/c21-13(11-25-14(22)12-7-3-1-4-8-12)19-20-15(23)17(18-16(20)24)9-5-2-6-10-17/h1,3-4,7-8H,2,5-6,9-11H2,(H,18,24)(H,19,21) |
| InChIKey | QXWSGTFWLVKWEU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|