C21H22N4O6 — CID 16505285
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 16505285) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 16505285 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)OCC(=O)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C21H22N4O6/c1-13-16(17(24-31-13)14-8-4-2-5-9-14)18(27)30-12-15(26)23-25-19(28)21(22-20(25)29)10-6-3-7-11-21/h2,4-5,8-9H,3,6-7,10-12H2,1H3,(H,22,29)(H,23,26) |
| InChIKey | AMBUTOIPNZNSDS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|