C15H19N5O5 — CID 16575783
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 1-methylpyrazole-4-carboxylate (PubChem CID 16575783) has the molecular formula C15H19N5O5 and a molecular weight of 349.35 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 1-methylpyrazole-4-carboxylate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 16575783 |
| Molecular Formula | C15H19N5O5 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 1-methylpyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)OCC(=O)NN2C(=O)NC3(CCCCC3)C2=O)cn1 |
| InChI | InChI=1S/C15H19N5O5/c1-19-8-10(7-16-19)12(22)25-9-11(21)18-20-13(23)15(17-14(20)24)5-3-2-4-6-15/h7-8H,2-6,9H2,1H3,(H,17,24)(H,18,21) |
| InChIKey | MNAZXDWAISPQPS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|