C20H20ClN5O5 — CID 16604461
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(4-chlorophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 16604461) has the molecular formula C20H20ClN5O5 and a molecular weight of 445.86 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(4-chlorophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(4-chlorophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16604461 |
| Molecular Formula | C20H20ClN5O5 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(4-chlorophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(Cl)cc2)n[nH]1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C20H20ClN5O5/c21-13-6-4-12(5-7-13)14-10-15(24-23-14)17(28)31-11-16(27)25-26-18(29)20(22-19(26)30)8-2-1-3-9-20/h4-7,10H,1-3,8-9,11H2,(H,22,30)(H,23,24)(H,25,27) |
| InChIKey | HVKPIVXXXAWICN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|